C21H23N3OS — CID 124811509
(3aS,4S,6aR)-2-[(5-methylthiophen-2-yl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 124811509) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-[(5-methylthiophen-2-yl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aS,4S,6aR)-2-[(5-methylthiophen-2-yl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 124811509 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (3aS,4S,6aR)-2-[(5-methylthiophen-2-yl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | Cc1ccc(CN2C[C@@H]3CC[C@]4(N=C(c5ccccc5)NC4=O)[C@@H]3C2)s1 |
| InChI | InChI=1S/C21H23N3OS/c1-14-7-8-17(26-14)12-24-11-16-9-10-21(18(16)13-24)20(25)22-19(23-21)15-5-3-2-4-6-15/h2-8,16,18H,9-13H2,1H3,(H,22,23,25)/t16-,18+,21-/m0/s1 |
| InChIKey | BHXPKMQXTSBESX-CDXJDZJCSA-N |
| XLogP | 3.21 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |