C15H17FN4O2S — CID 124811538
(3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 124811538) has the molecular formula C15H17FN4O2S and a molecular weight of 336.39 g/mol. Its IUPAC name is (3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 124811538 |
| Molecular Formula | C15H17FN4O2S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | Cc1nc(CO[C@@H]2CN(c3ncc(F)cn3)[C@H]3COC[C@@H]23)cs1 |
| InChI | InChI=1S/C15H17FN4O2S/c1-9-19-11(8-23-9)5-22-14-4-20(13-7-21-6-12(13)14)15-17-2-10(16)3-18-15/h2-3,8,12-14H,4-7H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | SWQZGBZCTZWDDZ-HZSPNIEDSA-N |
| XLogP | 1.80 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |