C13H20N4O2S — CID 124811934
(2S,3aR,7aR)-N,N-dimethyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 124811934) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is (2S,3aR,7aR)-N,N-dimethyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2S,3aR,7aR)-N,N-dimethyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124811934 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S,3aR,7aR)-N,N-dimethyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | Cc1nnc(N2CC[C@@H]3C[C@@H](C(=O)N(C)C)O[C@H]3C2)s1 |
| InChI | InChI=1S/C13H20N4O2S/c1-8-14-15-13(20-8)17-5-4-9-6-10(12(18)16(2)3)19-11(9)7-17/h9-11H,4-7H2,1-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | YNSOJFGXVPMZMO-VWYCJHECSA-N |
| XLogP | 0.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |