C10H16O2 — CID 124812816
(1S,2S,3R,4R,6R,7S)-tricyclo[5.2.1.02,6]decane-3,4-diol (PubChem CID 124812816) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1S,2S,3R,4R,6R,7S)-tricyclo[5.2.1.02,6]decane-3,4-diol.
| Compound Name | (1S,2S,3R,4R,6R,7S)-tricyclo[5.2.1.02,6]decane-3,4-diol |
|---|---|
| PubChem CID | 124812816 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (1S,2S,3R,4R,6R,7S)-tricyclo[5.2.1.02,6]decane-3,4-diol |
| SMILES | O[C@@H]1[C@H]2[C@H]3CC[C@@H](C3)[C@H]2C[C@H]1O |
| InChI | InChI=1S/C10H16O2/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12/h5-12H,1-4H2/t5-,6-,7+,8+,9-,10-/m0/s1 |
| InChIKey | XZDKBXDSOIMBNM-HMELBQQSSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |