C24H33N3O — CID 124813932
(2R)-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-2-phenylbutanamide (PubChem CID 124813932) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is (2R)-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 124813932 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (2R)-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)NCCCN1CCN(C)C[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33N3O/c1-3-22(20-11-6-4-7-12-20)24(28)25-15-10-16-27-18-17-26(2)19-23(27)21-13-8-5-9-14-21/h4-9,11-14,22-23H,3,10,15-19H2,1-2H3,(H,25,28)/t22-,23+/m1/s1 |
| InChIKey | RJRIUJQONRIONQ-PKTZIBPZSA-N |
| XLogP | 3.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|