C21H29N3O — CID 124814054
(3aS,4S,6aR)-2',3'-diethyl-2-[(4-methylphenyl)methyl]spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one (PubChem CID 124814054) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (3aS,4S,6aR)-2',3'-diethyl-2-[(4-methylphenyl)methyl]spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one.
| Compound Name | (3aS,4S,6aR)-2',3'-diethyl-2-[(4-methylphenyl)methyl]spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 124814054 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (3aS,4S,6aR)-2',3'-diethyl-2-[(4-methylphenyl)methyl]spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one |
| SMILES | CCC1=N[C@]2(CC[C@H]3CN(Cc4ccc(C)cc4)C[C@H]32)C(=O)N1CC |
| InChI | InChI=1S/C21H29N3O/c1-4-19-22-21(20(25)24(19)5-2)11-10-17-13-23(14-18(17)21)12-16-8-6-15(3)7-9-16/h6-9,17-18H,4-5,10-14H2,1-3H3/t17-,18+,21-/m0/s1 |
| InChIKey | KLBLXWHIMHYYRI-UEXGIBASSA-N |
| XLogP | 3.25 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |