C26H37N3O2S2 — CID 124814781
(2S)-2-[(3-cyclopentyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 124814781) has the molecular formula C26H37N3O2S2 and a molecular weight of 487.74 g/mol. Its IUPAC name is (2S)-2-[(3-cyclopentyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2S)-2-[(3-cyclopentyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 124814781 |
| Molecular Formula | C26H37N3O2S2 |
| Molecular Weight | 487.74 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (2S)-2-[(3-cyclopentyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)[C@H](C)Sc1nc2sc3c(c2c(=O)n1C1CCCC1)CCCC3 |
| InChI | InChI=1S/C26H37N3O2S2/c1-15-9-8-13-20(16(15)2)27-23(30)17(3)32-26-28-24-22(19-12-6-7-14-21(19)33-24)25(31)29(26)18-10-4-5-11-18/h15-18,20H,4-14H2,1-3H3,(H,27,30)/t15-,16-,17+,20-/m1/s1 |
| InChIKey | MFEACPAEXDUKQS-PDOICOKGSA-N |
| XLogP | 5.87 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |