C22H20N4O — CID 124815324
(1S,12S)-15-benzyl-7-(furan-2-yl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 124815324) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is (1S,12S)-15-benzyl-7-(furan-2-yl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,12S)-15-benzyl-7-(furan-2-yl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 124815324 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1S,12S)-15-benzyl-7-(furan-2-yl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | c1ccc(CN2[C@H]3CC[C@H]2c2cnc4cc(-c5ccco5)nn4c2C3)cc1 |
| InChI | InChI=1S/C22H20N4O/c1-2-5-15(6-3-1)14-25-16-8-9-19(25)17-13-23-22-12-18(21-7-4-10-27-21)24-26(22)20(17)11-16/h1-7,10,12-13,16,19H,8-9,11,14H2/t16-,19-/m0/s1 |
| InChIKey | JXNHBDYPLYRYKG-LPHOPBHVSA-N |
| XLogP | 4.25 |
| TPSA | 46.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |