About (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide
(8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide (PubChem CID 124816625) has the molecular formula C14H23N3O3S
and a molecular weight of 313.42 g/mol. Its IUPAC name is (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide.
Molecular Properties
| Compound Name | (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide |
| PubChem CID | 124816625 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide |
| SMILES | CCOC[C@H]1CCS(=O)(=O)C12CN(Cc1cnn(C)c1)C2 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-20-9-13-4-5-21(18,19)14(13)10-17(11-14)8-12-6-15-16(2)7-12/h6-7,13H,3-5,8-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | JARIIXMROSJLJN-CYBMUJFWSA-N |
| XLogP | 0.45 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
The IUPAC name of (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide (CID 124816625) is (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide.
What is the SMILES notation for (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
The canonical SMILES for (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide is CCOC[C@H]1CCS(=O)(=O)C12CN(Cc1cnn(C)c1)C2.
What is the InChIKey of (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
The InChIKey is JARIIXMROSJLJN-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H23N3O3S/c1-3-20-9-13-4-5-21(18,19)14(13)10-17(11-14)8-12-6-15-16(2)7-12/h6-7,13H,3-5,8-11H2,1-2H3/t13-/m1/s1.
What are the key properties of (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
(8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide has a molecular weight of 313.42 g/mol, XLogP of 0.45, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-8-(ethoxymethyl)-2-[(1-methylpyrazol-4-yl)methyl]-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide is sourced from PubChem (CID 124816625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).