C17H19ClN4O2 — CID 124817035
(3S,3aR,6aR)-5-(5-chloropyrimidin-2-yl)-3-[(6-methyl-3-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 124817035) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-(5-chloropyrimidin-2-yl)-3-[(6-methyl-3-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3S,3aR,6aR)-5-(5-chloropyrimidin-2-yl)-3-[(6-methyl-3-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124817035 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3S,3aR,6aR)-5-(5-chloropyrimidin-2-yl)-3-[(6-methyl-3-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1ccc(OC[C@@H]2CO[C@H]3CN(c4ncc(Cl)cn4)C[C@@H]23)cn1 |
| InChI | InChI=1S/C17H19ClN4O2/c1-11-2-3-14(6-19-11)23-9-12-10-24-16-8-22(7-15(12)16)17-20-4-13(18)5-21-17/h2-6,12,15-16H,7-10H2,1H3/t12-,15+,16+/m1/s1 |
| InChIKey | VBQFUFQTXLKCRY-KCXAZCMYSA-N |
| XLogP | 2.36 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |