C26H21N3O7 — CID 124817461
[(1R,2R,3S,3aS)-2-(4-hydroxy-3-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 124817461) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is [(1R,2R,3S,3aS)-2-(4-hydroxy-3-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(1R,2R,3S,3aS)-2-(4-hydroxy-3-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 124817461 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [(1R,2R,3S,3aS)-2-(4-hydroxy-3-methoxyphenyl)-3-nitro-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1cc([C@H]2[C@H]([N+](=O)[O-])[C@@H]3C=Cc4ccccc4N3[C@H]2C(=O)c2cccc([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C26H21N3O7/c1-36-22-14-16(10-12-21(22)30)23-24(29(34)35)20-11-9-15-5-2-3-8-19(15)27(20)25(23)26(31)17-6-4-7-18(13-17)28(32)33/h2-14,20,23-25,30H,1H3/t20-,23-,24+,25+/m0/s1 |
| InChIKey | DMYBEYYSUCWYDA-MNPDLOSFSA-N |
| XLogP | 4.20 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|