C22H26N4O4 — CID 124818173
2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(S)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]acetamide (PubChem CID 124818173) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(S)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]acetamide.
| Compound Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(S)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 124818173 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(S)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]acetamide |
| SMILES | COc1ccc([C@H](NC(=O)CN2C(=O)[C@@H]3CCCC[C@H]3C2=O)c2nccn2C)cc1 |
| InChI | InChI=1S/C22H26N4O4/c1-25-12-11-23-20(25)19(14-7-9-15(30-2)10-8-14)24-18(27)13-26-21(28)16-5-3-4-6-17(16)22(26)29/h7-12,16-17,19H,3-6,13H2,1-2H3,(H,24,27)/t16-,17-,19+/m1/s1 |
| InChIKey | NAJMWRJNQMYJTK-LMMKCTJWSA-N |
| XLogP | 1.81 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|