C15H26N4O — CID 124819712
(3aS,7aR)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 124819712) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is (3aS,7aR)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | (3aS,7aR)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 124819712 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3aS,7aR)-5-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | COCCN1CC[C@H]2CN(Cc3nccn3C)C[C@H]2C1 |
| InChI | InChI=1S/C15H26N4O/c1-17-6-4-16-15(17)12-19-9-13-3-5-18(7-8-20-2)10-14(13)11-19/h4,6,13-14H,3,5,7-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | RFNVIJXIALVZJD-UONOGXRCSA-N |
| XLogP | 0.82 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |