C21H24N2O3 — CID 124821748
(4-methylphenyl)-[(8R)-8-(pyridin-2-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone (PubChem CID 124821748) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4-methylphenyl)-[(8R)-8-(pyridin-2-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone.
| Compound Name | (4-methylphenyl)-[(8R)-8-(pyridin-2-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone |
|---|---|
| PubChem CID | 124821748 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (4-methylphenyl)-[(8R)-8-(pyridin-2-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CC3(C[C@H](OCc4ccccn4)CCO3)C2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-16-5-7-17(8-6-16)20(24)23-14-21(15-23)12-19(9-11-26-21)25-13-18-4-2-3-10-22-18/h2-8,10,19H,9,11-15H2,1H3/t19-/m1/s1 |
| InChIKey | PFLVISOIBNJMOH-LJQANCHMSA-N |
| XLogP | 2.98 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |