C12H20O6 — CID 124822533
(1R,4S,5R,6S,7S)-1-[(1S)-1-hydroxybutyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-4,5,6,7-tetrol (PubChem CID 124822533) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1R,4S,5R,6S,7S)-1-[(1S)-1-hydroxybutyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-4,5,6,7-tetrol.
| Compound Name | (1R,4S,5R,6S,7S)-1-[(1S)-1-hydroxybutyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-4,5,6,7-tetrol |
|---|---|
| PubChem CID | 124822533 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1R,4S,5R,6S,7S)-1-[(1S)-1-hydroxybutyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-4,5,6,7-tetrol |
| SMILES | CCC[C@H](O)[C@@H]1OCC2=C1[C@H](O)[C@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C12H20O6/c1-2-3-6(13)12-7-5(4-18-12)8(14)10(16)11(17)9(7)15/h6,8-17H,2-4H2,1H3/t6-,8-,9-,10+,11-,12-/m0/s1 |
| InChIKey | TWDKEWYUAIMHMA-FSRYBXGGSA-N |
| XLogP | -1.70 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|