C26H34N2O4 — CID 124823302
(1S,3S,4aR,9aR)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-6-hydroxy-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 124823302) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is (1S,3S,4aR,9aR)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-6-hydroxy-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1S,3S,4aR,9aR)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-6-hydroxy-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 124823302 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (1S,3S,4aR,9aR)-1-(3,5-ditert-butyl-4-hydroxyphenyl)-6-hydroxy-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CC(C)(C)c1cc([C@@H]2N[C@H](C(=O)O)C[C@@H]3c4cc(O)ccc4N[C@H]32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H34N2O4/c1-25(2,3)17-9-13(10-18(23(17)30)26(4,5)6)21-22-16(12-20(28-21)24(31)32)15-11-14(29)7-8-19(15)27-22/h7-11,16,20-22,27-30H,12H2,1-6H3,(H,31,32)/t16-,20+,21+,22-/m1/s1 |
| InChIKey | RMBQXZLGTAJQLR-YPVJZLTNSA-N |
| XLogP | 4.76 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|