C24H28N2O4 — CID 124823414
(1'S,2R,2'R,4'R)-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 124823414) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (1'S,2R,2'R,4'R)-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'S,2R,2'R,4'R)-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 124823414 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1'S,2R,2'R,4'R)-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | C[C@H](CCc1ccco1)NC(=O)[C@@H]1C[C@H]2CC[C@H]1C[C@]21NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C24H28N2O4/c1-15(8-11-18-5-4-12-29-18)25-22(27)20-13-17-10-9-16(20)14-24(17)26-23(28)19-6-2-3-7-21(19)30-24/h2-7,12,15-17,20H,8-11,13-14H2,1H3,(H,25,27)(H,26,28)/t15-,16+,17-,20-,24-/m1/s1 |
| InChIKey | XWGMAROFAMSYGK-AGYLXNLDSA-N |
| XLogP | 3.67 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |