C23H21ClN2O3S — CID 124823555
(10S,11R,15S,16R)-13-butyl-5-chloro-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 124823555) has the molecular formula C23H21ClN2O3S and a molecular weight of 440.95 g/mol. Its IUPAC name is (10S,11R,15S,16R)-13-butyl-5-chloro-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11R,15S,16R)-13-butyl-5-chloro-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 124823555 |
| Molecular Formula | C23H21ClN2O3S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (10S,11R,15S,16R)-13-butyl-5-chloro-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CCCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H](C(=O)c1cccs1)N1c3ccc(Cl)cc3C=C[C@@H]21 |
| InChI | InChI=1S/C23H21ClN2O3S/c1-2-3-10-25-22(28)18-16-8-6-13-12-14(24)7-9-15(13)26(16)20(19(18)23(25)29)21(27)17-5-4-11-30-17/h4-9,11-12,16,18-20H,2-3,10H2,1H3/t16-,18-,19-,20+/m0/s1 |
| InChIKey | DHFHICQQFCQDAA-FRYIKTPZSA-N |
| XLogP | 4.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|