C24H29BrN4O — CID 124823860
1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]-N-butylpiperidine-4-carboxamide (PubChem CID 124823860) has the molecular formula C24H29BrN4O and a molecular weight of 469.43 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]-N-butylpiperidine-4-carboxamide.
| Compound Name | 1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]-N-butylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 124823860 |
| Molecular Formula | C24H29BrN4O |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]-N-butylpiperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(Cc2nc3ccccc3n2-c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C24H29BrN4O/c1-2-3-14-26-24(30)18-12-15-28(16-13-18)17-23-27-21-6-4-5-7-22(21)29(23)20-10-8-19(25)9-11-20/h4-11,18H,2-3,12-17H2,1H3,(H,26,30) |
| InChIKey | LIXPCQQBCAXWLE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|