C15H23FN4O — CID 124823961
N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-N-ethylethanamine (PubChem CID 124823961) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-N-ethylethanamine.
| Compound Name | N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 124823961 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-N-ethylethanamine |
| SMILES | CCN(CC)C[C@@H]1CO[C@H]2CN(c3ncc(F)cn3)C[C@@H]12 |
| InChI | InChI=1S/C15H23FN4O/c1-3-19(4-2)7-11-10-21-14-9-20(8-13(11)14)15-17-5-12(16)6-18-15/h5-6,11,13-14H,3-4,7-10H2,1-2H3/t11-,13+,14+/m1/s1 |
| InChIKey | DPRPIGWHHROKTE-XBFCOCLRSA-N |
| XLogP | 1.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |