C23H23Cl2NO2 — CID 124824192
ethyl (1S,2R,10S,11R,12S)-10-(2,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylate (PubChem CID 124824192) has the molecular formula C23H23Cl2NO2 and a molecular weight of 416.35 g/mol. Its IUPAC name is ethyl (1S,2R,10S,11R,12S)-10-(2,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylate.
| Compound Name | ethyl (1S,2R,10S,11R,12S)-10-(2,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylate |
|---|---|
| PubChem CID | 124824192 |
| Molecular Formula | C23H23Cl2NO2 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | ethyl (1S,2R,10S,11R,12S)-10-(2,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@@H](c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C23H23Cl2NO2/c1-2-28-23(27)14-5-8-19-17(10-14)20-12-3-4-13(9-12)21(20)22(26-19)16-7-6-15(24)11-18(16)25/h5-8,10-13,20-22,26H,2-4,9H2,1H3/t12-,13-,20-,21+,22+/m0/s1 |
| InChIKey | BLQIUYJCPHQGEL-SEHKKCDASA-N |
| XLogP | 6.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |