C15H26N6 — CID 124824334
6-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-N-ethyl-N-methylpyrimidin-4-amine (PubChem CID 124824334) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is 6-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-N-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-N-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 124824334 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 6-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-N-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCN(C)c1cc(N2CCN3CCN(C)C[C@H]3C2)ncn1 |
| InChI | InChI=1S/C15H26N6/c1-4-19(3)14-9-15(17-12-16-14)21-8-7-20-6-5-18(2)10-13(20)11-21/h9,12-13H,4-8,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | IBYHALWLYAZVAH-ZDUSSCGKSA-N |
| XLogP | 0.37 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |