C21H33N3O — CID 124824586
(2S)-1-(2-methylpropyl)-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]piperidine-2-carboxamide (PubChem CID 124824586) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is (2S)-1-(2-methylpropyl)-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-(2-methylpropyl)-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 124824586 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (2S)-1-(2-methylpropyl)-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]piperidine-2-carboxamide |
| SMILES | CC(C)CN1CCCC[C@H]1C(=O)NC[C@H]1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C21H33N3O/c1-17(2)15-24-12-7-6-10-20(24)21(25)22-14-18-11-13-23(16-18)19-8-4-3-5-9-19/h3-5,8-9,17-18,20H,6-7,10-16H2,1-2H3,(H,22,25)/t18-,20+/m1/s1 |
| InChIKey | QUXMEOPLYQNOGA-QUCCMNQESA-N |
| XLogP | 3.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |