C40H56N2O10 — CID 124824615
tetrabutyl (1S,2S,3R,5S,6S,7S)-1,5-bis(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate (PubChem CID 124824615) has the molecular formula C40H56N2O10 and a molecular weight of 724.89 g/mol. Its IUPAC name is tetrabutyl (1S,2S,3R,5S,6S,7S)-1,5-bis(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate.
| Compound Name | tetrabutyl (1S,2S,3R,5S,6S,7S)-1,5-bis(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 124824615 |
| Molecular Formula | C40H56N2O10 |
| Molecular Weight | 724.89 g/mol |
| Exact Mass | 724.39 |
| IUPAC Name | tetrabutyl (1S,2S,3R,5S,6S,7S)-1,5-bis(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1[C@@H](C(=O)OCCCC)N2[C@H](c3ccc(OC)cc3)[C@H](C(=O)OCCCC)[C@H](C(=O)OCCCC)N2[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C40H56N2O10/c1-7-11-23-49-37(43)31-33(27-15-19-29(47-5)20-16-27)41-36(40(46)52-26-14-10-4)32(38(44)50-24-12-8-2)34(28-17-21-30(48-6)22-18-28)42(41)35(31)39(45)51-25-13-9-3/h15-22,31-36H,7-14,23-26H2,1-6H3/t31-,32-,33+,34+,35-,36+/m0/s1 |
| InChIKey | NERKMJDVFQUVDB-BAMNLDOISA-N |
| XLogP | 6.38 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|