C13H17NO4 — CID 124825750
(3aS,4R,7R,7aR)-2-(3-methylbutoxy)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 124825750) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (3aS,4R,7R,7aR)-2-(3-methylbutoxy)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7R,7aR)-2-(3-methylbutoxy)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 124825750 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (3aS,4R,7R,7aR)-2-(3-methylbutoxy)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC(C)CCON1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C13H17NO4/c1-7(2)5-6-17-14-12(15)10-8-3-4-9(18-8)11(10)13(14)16/h3-4,7-11H,5-6H2,1-2H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | OOVTXBXXEMGLGO-DBIOUOCHSA-N |
| XLogP | 0.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|