C11H20N2O2S — CID 124826404
(4aR,7aS)-4-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 124826404) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (4aR,7aS)-4-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 124826404 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (4aR,7aS)-4-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C11H20N2O2S/c1-9(2)3-5-13-6-4-12-10-7-16(14,15)8-11(10)13/h3,10-12H,4-8H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | XFSUXGZYYLWFRJ-MNOVXSKESA-N |
| XLogP | 0.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|