C26H31NO7 — CID 124826515
ethyl (6S,7R,8R)-8-(2,4-dimethoxyphenyl)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromene-7-carboxylate (PubChem CID 124826515) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is ethyl (6S,7R,8R)-8-(2,4-dimethoxyphenyl)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromene-7-carboxylate.
| Compound Name | ethyl (6S,7R,8R)-8-(2,4-dimethoxyphenyl)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromene-7-carboxylate |
|---|---|
| PubChem CID | 124826515 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | ethyl (6S,7R,8R)-8-(2,4-dimethoxyphenyl)-6-methyl-6-pyrrolidin-1-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromene-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(OC)cc2OC)c2cc3c(cc2O[C@]1(C)N1CCCC1)OCO3 |
| InChI | InChI=1S/C26H31NO7/c1-5-31-25(28)24-23(17-9-8-16(29-3)12-19(17)30-4)18-13-21-22(33-15-32-21)14-20(18)34-26(24,2)27-10-6-7-11-27/h8-9,12-14,23-24H,5-7,10-11,15H2,1-4H3/t23-,24+,26+/m1/s1 |
| InChIKey | NCKUASWULOOIHH-USZFVNFHSA-N |
| XLogP | 3.95 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |