C24H26N2O4 — CID 124827083
methyl 4-[(1S,2R,10R,11R,12S)-4,5-dimethyl-7-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trien-10-yl]benzoate (PubChem CID 124827083) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 4-[(1S,2R,10R,11R,12S)-4,5-dimethyl-7-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trien-10-yl]benzoate.
| Compound Name | methyl 4-[(1S,2R,10R,11R,12S)-4,5-dimethyl-7-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trien-10-yl]benzoate |
|---|---|
| PubChem CID | 124827083 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl 4-[(1S,2R,10R,11R,12S)-4,5-dimethyl-7-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-trien-10-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3c([N+](=O)[O-])cc(C)c(C)c3[C@@H]3[C@H]4CC[C@@H](C4)[C@H]32)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-12-10-18(26(28)29)23-19(13(12)2)20-16-8-9-17(11-16)21(20)22(25-23)14-4-6-15(7-5-14)24(27)30-3/h4-7,10,16-17,20-22,25H,8-9,11H2,1-3H3/t16-,17-,20-,21+,22-/m0/s1 |
| InChIKey | FHZDGUSPLSRXEE-BVKOHWRASA-N |
| XLogP | 5.29 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|