C22H33N3O4S — CID 124827103
[(3S,5S)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone (PubChem CID 124827103) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is [(3S,5S)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone.
| Compound Name | [(3S,5S)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
|---|---|
| PubChem CID | 124827103 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [(3S,5S)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
| SMILES | COc1cccc([C@@H]2C[C@@H](C(=O)N3C[C@@]4(C)C[C@H]3CC(C)(C)C4)N(C)S(=O)(=O)N2)c1 |
| InChI | InChI=1S/C22H33N3O4S/c1-21(2)11-16-12-22(3,13-21)14-25(16)20(26)19-10-18(23-30(27,28)24(19)4)15-7-6-8-17(9-15)29-5/h6-9,16,18-19,23H,10-14H2,1-5H3/t16-,18+,19+,22+/m1/s1 |
| InChIKey | FVEOZUYOASIHGX-ONZODILHSA-N |
| XLogP | 2.70 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |