C23H24N2O3 — CID 124827793
(1'S,2S,5'S,6'R)-N,6-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)spiro[3H-chromene-2,2'-bicyclo[3.1.0]hexane]-6'-carboxamide (PubChem CID 124827793) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1'S,2S,5'S,6'R)-N,6-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)spiro[3H-chromene-2,2'-bicyclo[3.1.0]hexane]-6'-carboxamide.
| Compound Name | (1'S,2S,5'S,6'R)-N,6-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)spiro[3H-chromene-2,2'-bicyclo[3.1.0]hexane]-6'-carboxamide |
|---|---|
| PubChem CID | 124827793 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (1'S,2S,5'S,6'R)-N,6-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)spiro[3H-chromene-2,2'-bicyclo[3.1.0]hexane]-6'-carboxamide |
| SMILES | Cc1ccc2c(c1)C(=O)C[C@]1(CC[C@@H]3[C@@H](C(=O)N(C)Cc4ccncc4)[C@H]31)O2 |
| InChI | InChI=1S/C23H24N2O3/c1-14-3-4-19-17(11-14)18(26)12-23(28-19)8-5-16-20(21(16)23)22(27)25(2)13-15-6-9-24-10-7-15/h3-4,6-7,9-11,16,20-21H,5,8,12-13H2,1-2H3/t16-,20-,21+,23+/m1/s1 |
| InChIKey | UTFYLUDVIZOOLB-VTUOOYILSA-N |
| XLogP | 3.41 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |