C23H28N4O3 — CID 124827905
(1S,13S)-16-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one (PubChem CID 124827905) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (1S,13S)-16-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one.
| Compound Name | (1S,13S)-16-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one |
|---|---|
| PubChem CID | 124827905 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (1S,13S)-16-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one |
| SMILES | CCOc1ccc(CN2[C@H]3CC[C@H]2Cc2c(nc4cc(C)[nH]n4c2=O)C3)cc1OC |
| InChI | InChI=1S/C23H28N4O3/c1-4-30-20-8-5-15(10-21(20)29-3)13-26-16-6-7-17(26)12-19-18(11-16)23(28)27-22(24-19)9-14(2)25-27/h5,8-10,16-17,25H,4,6-7,11-13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | URPBZYAFHCMVCS-IRXDYDNUSA-N |
| XLogP | 2.87 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |