C21H25N3O3 — CID 124828194
(2S)-1-[[3-[[(2R)-2-phenoxypropanoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 124828194) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S)-1-[[3-[[(2R)-2-phenoxypropanoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[[3-[[(2R)-2-phenoxypropanoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 124828194 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (2S)-1-[[3-[[(2R)-2-phenoxypropanoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)Nc1cccc(CN2CCC[C@H]2C(N)=O)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-15(27-18-9-3-2-4-10-18)21(26)23-17-8-5-7-16(13-17)14-24-12-6-11-19(24)20(22)25/h2-5,7-10,13,15,19H,6,11-12,14H2,1H3,(H2,22,25)(H,23,26)/t15-,19+/m1/s1 |
| InChIKey | FVGNVHWZPYYLBR-BEFAXECRSA-N |
| XLogP | 2.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |