C20H20N2O3 — CID 124828408
(10S,11R,15S,16S)-16-acetyl-5-methyl-13-prop-2-enyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 124828408) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (10S,11R,15S,16S)-16-acetyl-5-methyl-13-prop-2-enyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11R,15S,16S)-16-acetyl-5-methyl-13-prop-2-enyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 124828408 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (10S,11R,15S,16S)-16-acetyl-5-methyl-13-prop-2-enyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | C=CCN1C(=O)[C@@H]2[C@H](C1=O)[C@@H](C(C)=O)N1c3ccc(C)cc3C=C[C@@H]21 |
| InChI | InChI=1S/C20H20N2O3/c1-4-9-21-19(24)16-15-8-6-13-10-11(2)5-7-14(13)22(15)18(12(3)23)17(16)20(21)25/h4-8,10,15-18H,1,9H2,2-3H3/t15-,16-,17-,18+/m0/s1 |
| InChIKey | MRCAHFUVKMSZEB-XLAORIBOSA-N |
| XLogP | 1.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|