C17H23F3N2O — CID 124828974
(3S)-N-[(1S)-1-[(3S)-oxolan-3-yl]ethyl]-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-amine (PubChem CID 124828974) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is (3S)-N-[(1S)-1-[(3S)-oxolan-3-yl]ethyl]-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | (3S)-N-[(1S)-1-[(3S)-oxolan-3-yl]ethyl]-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 124828974 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (3S)-N-[(1S)-1-[(3S)-oxolan-3-yl]ethyl]-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
| SMILES | C[C@H](N[C@H]1CCN(c2ccccc2C(F)(F)F)C1)[C@@H]1CCOC1 |
| InChI | InChI=1S/C17H23F3N2O/c1-12(13-7-9-23-11-13)21-14-6-8-22(10-14)16-5-3-2-4-15(16)17(18,19)20/h2-5,12-14,21H,6-11H2,1H3/t12-,13+,14-/m0/s1 |
| InChIKey | DJYBUPJXFLDFGI-MJBXVCDLSA-N |
| XLogP | 3.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |