C18H24N4O3 — CID 124829021
(2S,3R)-N-[4-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]-2,3-dimethylpiperidine-1-carboxamide (PubChem CID 124829021) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is (2S,3R)-N-[4-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]-2,3-dimethylpiperidine-1-carboxamide.
| Compound Name | (2S,3R)-N-[4-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]-2,3-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 124829021 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2S,3R)-N-[4-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]-2,3-dimethylpiperidine-1-carboxamide |
| SMILES | C[C@@H]1CCCN(C(=O)Nc2ccc(C[C@@H]3NC(=O)NC3=O)cc2)[C@H]1C |
| InChI | InChI=1S/C18H24N4O3/c1-11-4-3-9-22(12(11)2)18(25)19-14-7-5-13(6-8-14)10-15-16(23)21-17(24)20-15/h5-8,11-12,15H,3-4,9-10H2,1-2H3,(H,19,25)(H2,20,21,23,24)/t11-,12+,15+/m1/s1 |
| InChIKey | ZAYJROHOBKWUTO-XUJVJEKNSA-N |
| XLogP | 2.09 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|