C16H24N2OS — CID 124829294
(1R,5R,6R)-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine (PubChem CID 124829294) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is (1R,5R,6R)-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine.
| Compound Name | (1R,5R,6R)-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
|---|---|
| PubChem CID | 124829294 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (1R,5R,6R)-N-[(1S)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
| SMILES | Cc1nc(C)c([C@H](C)N[C@@H]2[C@H]3CCO[C@H]3C23CCC3)s1 |
| InChI | InChI=1S/C16H24N2OS/c1-9-13(20-11(3)17-9)10(2)18-14-12-5-8-19-15(12)16(14)6-4-7-16/h10,12,14-15,18H,4-8H2,1-3H3/t10-,12+,14+,15+/m0/s1 |
| InChIKey | RRERBEUAHDSFNS-QMGNLALYSA-N |
| XLogP | 3.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |