C16H25N3O2 — CID 124829802
(9aS)-2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione (PubChem CID 124829802) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is (9aS)-2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione.
| Compound Name | (9aS)-2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
|---|---|
| PubChem CID | 124829802 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (9aS)-2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
| SMILES | CC1=CCC[C@H](C)[C@H]1CN1CCN2C(=O)C(=O)NC[C@H]2C1 |
| InChI | InChI=1S/C16H25N3O2/c1-11-4-3-5-12(2)14(11)10-18-6-7-19-13(9-18)8-17-15(20)16(19)21/h4,12-14H,3,5-10H2,1-2H3,(H,17,20)/t12-,13-,14-/m0/s1 |
| InChIKey | FYXURWJCLNMXEB-IHRRRGAJSA-N |
| XLogP | 0.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|