C17H32N2O2 — CID 124829911
(2R)-1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 124829911) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (2R)-1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 124829911 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2R)-1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CC1=CCC[C@H](C)[C@H]1CN(C)C[C@@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C17H32N2O2/c1-14-5-4-6-15(2)17(14)13-18(3)11-16(20)12-19-7-9-21-10-8-19/h5,15-17,20H,4,6-13H2,1-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | SLFDQKPTHQTVGG-BBWFWOEESA-N |
| XLogP | 1.60 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|