C15H21N3O2 — CID 124830226
[(1S,2R,3R,6R,7R)-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone (PubChem CID 124830226) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(1S,2R,3R,6R,7R)-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone.
| Compound Name | [(1S,2R,3R,6R,7R)-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 124830226 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [(1S,2R,3R,6R,7R)-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2C[C@@H]3C[C@H]4C[C@H]3[C@@H]2[C@@H]4O)n[nH]1 |
| InChI | InChI=1S/C15H21N3O2/c1-7(2)11-5-12(17-16-11)15(20)18-6-9-3-8-4-10(9)13(18)14(8)19/h5,7-10,13-14,19H,3-4,6H2,1-2H3,(H,16,17)/t8-,9-,10+,13+,14+/m0/s1 |
| InChIKey | HGXBCTLYOYRXGM-XSYNQRDESA-N |
| XLogP | 1.37 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |