C15H21N3O2 — CID 124830487
(2R,3aR,7aR)-6-ethyl-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 124830487) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2R,3aR,7aR)-6-ethyl-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2R,3aR,7aR)-6-ethyl-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124830487 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (2R,3aR,7aR)-6-ethyl-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | CCN1CC[C@@H]2C[C@H](C(=O)Nc3cccnc3)O[C@H]2C1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-18-7-5-11-8-13(20-14(11)10-18)15(19)17-12-4-3-6-16-9-12/h3-4,6,9,11,13-14H,2,5,7-8,10H2,1H3,(H,17,19)/t11-,13-,14+/m1/s1 |
| InChIKey | BLACWVBGXDASPP-BNOWGMLFSA-N |
| XLogP | 1.52 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |