C21H27N3O5S — CID 124831156
(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]propanamide (PubChem CID 124831156) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]propanamide.
| Compound Name | (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]propanamide |
|---|---|
| PubChem CID | 124831156 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]propanamide |
| SMILES | C[C@H](C(=O)NCCS(=O)(=O)N1CCc2ccccc21)N1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C21H27N3O5S/c1-14(24-20(26)16-7-3-4-8-17(16)21(24)27)19(25)22-11-13-30(28,29)23-12-10-15-6-2-5-9-18(15)23/h2,5-6,9,14,16-17H,3-4,7-8,10-13H2,1H3,(H,22,25)/t14-,16-,17-/m1/s1 |
| InChIKey | NIEGCYLOWUQAIB-DJIMGWMZSA-N |
| XLogP | 1.06 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|