C16H20FNO2 — CID 124831498
1-[(2R,3aR,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 124831498) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-[(2R,3aR,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[(2R,3aR,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 124831498 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[(2R,3aR,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | C[C@@H]1C[C@@H]2CN(C(=O)Cc3ccc(F)cc3)CC[C@@H]2O1 |
| InChI | InChI=1S/C16H20FNO2/c1-11-8-13-10-18(7-6-15(13)20-11)16(19)9-12-2-4-14(17)5-3-12/h2-5,11,13,15H,6-10H2,1H3/t11-,13-,15+/m1/s1 |
| InChIKey | UDAHPSMSBJOEEO-KYOSRNDESA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |