C20H25N3O2 — CID 124831906
(3aR,7aR)-2-[[(2R)-4-methyl-2-phenylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 124831906) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3aR,7aR)-2-[[(2R)-4-methyl-2-phenylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[[(2R)-4-methyl-2-phenylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124831906 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (3aR,7aR)-2-[[(2R)-4-methyl-2-phenylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CN1CCN(CN2C(=O)[C@@H]3CC=CC[C@H]3C2=O)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-21-11-12-22(18(13-21)15-7-3-2-4-8-15)14-23-19(24)16-9-5-6-10-17(16)20(23)25/h2-8,16-18H,9-14H2,1H3/t16-,17-,18+/m1/s1 |
| InChIKey | QVQGGBFDKOOJPX-KURKYZTESA-N |
| XLogP | 1.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|