C18H24N2O2S — CID 124831974
(9aS)-2-(3,4-dihydronaphthalen-2-ylsulfonyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 124831974) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is (9aS)-2-(3,4-dihydronaphthalen-2-ylsulfonyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (9aS)-2-(3,4-dihydronaphthalen-2-ylsulfonyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124831974 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (9aS)-2-(3,4-dihydronaphthalen-2-ylsulfonyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | O=S(=O)(C1=Cc2ccccc2CC1)N1CCN2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H24N2O2S/c21-23(22,18-9-8-15-5-1-2-6-16(15)13-18)20-12-11-19-10-4-3-7-17(19)14-20/h1-2,5-6,13,17H,3-4,7-12,14H2/t17-/m0/s1 |
| InChIKey | CGWQRUPPHMVIAI-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |