C11H17ClN4 — CID 124832471
4-chloro-6-[(3R)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine (PubChem CID 124832471) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 4-chloro-6-[(3R)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-chloro-6-[(3R)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 124832471 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-chloro-6-[(3R)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine |
| SMILES | CCN1CCN(c2cc(Cl)ncn2)C[C@H]1C |
| InChI | InChI=1S/C11H17ClN4/c1-3-15-4-5-16(7-9(15)2)11-6-10(12)13-8-14-11/h6,8-9H,3-5,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | IUGCGTHWIPOSIF-SECBINFHSA-N |
| XLogP | 1.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |