C22H24ClN3O3S — CID 124834122
2-[(2R,4aR,8aR)-3-oxo-1-(thiophene-2-carbonyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 124834122) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is 2-[(2R,4aR,8aR)-3-oxo-1-(thiophene-2-carbonyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[(2R,4aR,8aR)-3-oxo-1-(thiophene-2-carbonyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 124834122 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-[(2R,4aR,8aR)-3-oxo-1-(thiophene-2-carbonyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[C@@H]2C(=O)N[C@@H]3CCCC[C@H]3N2C(=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C22H24ClN3O3S/c1-13-8-9-14(11-15(13)23)24-20(27)12-18-21(28)25-16-5-2-3-6-17(16)26(18)22(29)19-7-4-10-30-19/h4,7-11,16-18H,2-3,5-6,12H2,1H3,(H,24,27)(H,25,28)/t16-,17-,18-/m1/s1 |
| InChIKey | KGKZYLYLFMCUMG-KZNAEPCWSA-N |
| XLogP | 3.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |