C17H18BrF3N2O2 — CID 124835047
[(3S,3aS,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-bromophenyl)methanone (PubChem CID 124835047) has the molecular formula C17H18BrF3N2O2 and a molecular weight of 419.24 g/mol. Its IUPAC name is [(3S,3aS,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-bromophenyl)methanone.
| Compound Name | [(3S,3aS,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-bromophenyl)methanone |
|---|---|
| PubChem CID | 124835047 |
| Molecular Formula | C17H18BrF3N2O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [(3S,3aS,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-bromophenyl)methanone |
| SMILES | CC[C@@H]1CCC2=NN(C(=O)c3ccc(Br)cc3)[C@@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C17H18BrF3N2O2/c1-2-10-3-8-14-13(9-10)16(25,17(19,20)21)23(22-14)15(24)11-4-6-12(18)7-5-11/h4-7,10,13,25H,2-3,8-9H2,1H3/t10-,13+,16+/m1/s1 |
| InChIKey | GKMDCJLHGHHLQT-HICWGWBUSA-N |
| XLogP | 4.34 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |