C13H27N3O2S — CID 124835693
[(2R,3R)-1-(azepan-1-ylsulfonyl)-3-methylpiperidin-2-yl]methanamine (PubChem CID 124835693) has the molecular formula C13H27N3O2S and a molecular weight of 289.45 g/mol. Its IUPAC name is [(2R,3R)-1-(azepan-1-ylsulfonyl)-3-methylpiperidin-2-yl]methanamine.
| Compound Name | [(2R,3R)-1-(azepan-1-ylsulfonyl)-3-methylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 124835693 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [(2R,3R)-1-(azepan-1-ylsulfonyl)-3-methylpiperidin-2-yl]methanamine |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)N2CCCCCC2)[C@H]1CN |
| InChI | InChI=1S/C13H27N3O2S/c1-12-7-6-10-16(13(12)11-14)19(17,18)15-8-4-2-3-5-9-15/h12-13H,2-11,14H2,1H3/t12-,13+/m1/s1 |
| InChIKey | FREMGPMCPWVKSK-OLZOCXBDSA-N |
| XLogP | 1.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |