C16H27NO — CID 124835824
1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclopentylethanone (PubChem CID 124835824) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclopentylethanone.
| Compound Name | 1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 124835824 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-cyclopentylethanone |
| SMILES | C[C@@H]1C[C@H]2CCCC[C@H]2N1C(=O)CC1CCCC1 |
| InChI | InChI=1S/C16H27NO/c1-12-10-14-8-4-5-9-15(14)17(12)16(18)11-13-6-2-3-7-13/h12-15H,2-11H2,1H3/t12-,14-,15-/m1/s1 |
| InChIKey | WKVWAEXOZPNZLI-BPLDGKMQSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |