C23H35NO5 — CID 124836212
ethyl (3R)-1-[[(1R,3R,4R,5R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperidine-3-carboxylate (PubChem CID 124836212) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl (3R)-1-[[(1R,3R,4R,5R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[[(1R,3R,4R,5R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 124836212 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | ethyl (3R)-1-[[(1R,3R,4R,5R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C[C@@H]2C(=O)O[C@@H]3C[C@@]4(C)CCC[C@H](C)[C@@]45O[C@@H]5[C@H]23)C1 |
| InChI | InChI=1S/C23H35NO5/c1-4-27-20(25)15-8-6-10-24(12-15)13-16-18-17(28-21(16)26)11-22(3)9-5-7-14(2)23(22)19(18)29-23/h14-19H,4-13H2,1-3H3/t14-,15+,16-,17+,18+,19+,22+,23-/m0/s1 |
| InChIKey | NNDFFLFUGPXXIM-IHXBAGIXSA-N |
| XLogP | 2.79 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|